C21H20Cl2N2O4 — CID 4657844
5-[(3-chloro-5-ethoxy-4-propan-2-yloxyphenyl)methylidene]-3-(3-chlorophenyl)imidazolidine-2,4-dione (PubChem CID 4657844) has the molecular formula C21H20Cl2N2O4 and a molecular weight of 435.31 g/mol. Its IUPAC name is 5-[(3-chloro-5-ethoxy-4-propan-2-yloxyphenyl)methylidene]-3-(3-chlorophenyl)imidazolidine-2,4-dione.
| Compound Name | 5-[(3-chloro-5-ethoxy-4-propan-2-yloxyphenyl)methylidene]-3-(3-chlorophenyl)imidazolidine-2,4-dione |
|---|---|
| PubChem CID | 4657844 |
| Molecular Formula | C21H20Cl2N2O4 |
| Molecular Weight | 435.31 g/mol |
| Exact Mass | 434.08 |
| IUPAC Name | 5-[(3-chloro-5-ethoxy-4-propan-2-yloxyphenyl)methylidene]-3-(3-chlorophenyl)imidazolidine-2,4-dione |
| SMILES | CCOc1cc(C=C2NC(=O)N(c3cccc(Cl)c3)C2=O)cc(Cl)c1OC(C)C |
| InChI | InChI=1S/C21H20Cl2N2O4/c1-4-28-18-10-13(8-16(23)19(18)29-12(2)3)9-17-20(26)25(21(27)24-17)15-7-5-6-14(22)11-15/h5-12H,4H2,1-3H3,(H,24,27) |
| InChIKey | UPSAGJOQQQFLQU-UHFFFAOYSA-N |
| XLogP | 5.28 |
| TPSA | 67.87 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 435.31 |
| LogP ≤ 5 | 5.28 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'hydantoin', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|