C28H25N3O6 — CID 126018040
(5E)-5-[[3-ethoxy-4-[(3-nitrophenyl)methoxy]-5-prop-2-enylphenyl]methylidene]-3-phenylimidazolidine-2,4-dione (PubChem CID 126018040) has the molecular formula C28H25N3O6 and a molecular weight of 499.52 g/mol. Its IUPAC name is (5E)-5-[[3-ethoxy-4-[(3-nitrophenyl)methoxy]-5-prop-2-enylphenyl]methylidene]-3-phenylimidazolidine-2,4-dione.
| Compound Name | (5E)-5-[[3-ethoxy-4-[(3-nitrophenyl)methoxy]-5-prop-2-enylphenyl]methylidene]-3-phenylimidazolidine-2,4-dione |
|---|---|
| PubChem CID | 126018040 |
| Molecular Formula | C28H25N3O6 |
| Molecular Weight | 499.52 g/mol |
| Exact Mass | 499.17 |
| IUPAC Name | (5E)-5-[[3-ethoxy-4-[(3-nitrophenyl)methoxy]-5-prop-2-enylphenyl]methylidene]-3-phenylimidazolidine-2,4-dione |
| SMILES | C=CCc1cc(/C=C2/NC(=O)N(c3ccccc3)C2=O)cc(OCC)c1OCc1cccc([N+](=O)[O-])c1 |
| InChI | InChI=1S/C28H25N3O6/c1-3-9-21-14-20(16-24-27(32)30(28(33)29-24)22-11-6-5-7-12-22)17-25(36-4-2)26(21)37-18-19-10-8-13-23(15-19)31(34)35/h3,5-8,10-17H,1,4,9,18H2,2H3,(H,29,33)/b24-16+ |
| InChIKey | NLEUDKZGQRJSPG-LFVJCYFKSA-N |
| XLogP | 5.40 |
| TPSA | 111.01 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 37 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 499.52 |
| LogP ≤ 5 | 5.40 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'hydantoin', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|