C28H23N3O5S — CID 21230405
(2E)-2-[[3-ethoxy-4-[(3-nitrophenyl)methoxy]-5-prop-2-enylphenyl]methylidene]-[1,3]thiazolo[3,2-a]benzimidazol-1-one (PubChem CID 21230405) has the molecular formula C28H23N3O5S and a molecular weight of 513.58 g/mol. Its IUPAC name is (2E)-2-[[3-ethoxy-4-[(3-nitrophenyl)methoxy]-5-prop-2-enylphenyl]methylidene]-[1,3]thiazolo[3,2-a]benzimidazol-1-one.
| Compound Name | (2E)-2-[[3-ethoxy-4-[(3-nitrophenyl)methoxy]-5-prop-2-enylphenyl]methylidene]-[1,3]thiazolo[3,2-a]benzimidazol-1-one |
|---|---|
| PubChem CID | 21230405 |
| Molecular Formula | C28H23N3O5S |
| Molecular Weight | 513.58 g/mol |
| Exact Mass | 513.14 |
| IUPAC Name | (2E)-2-[[3-ethoxy-4-[(3-nitrophenyl)methoxy]-5-prop-2-enylphenyl]methylidene]-[1,3]thiazolo[3,2-a]benzimidazol-1-one |
| SMILES | C=CCc1cc(/C=c2/sc3nc4ccccc4n3c2=O)cc(OCC)c1OCc1cccc([N+](=O)[O-])c1 |
| InChI | InChI=1S/C28H23N3O5S/c1-3-8-20-13-19(16-25-27(32)30-23-12-6-5-11-22(23)29-28(30)37-25)15-24(35-4-2)26(20)36-17-18-9-7-10-21(14-18)31(33)34/h3,5-7,9-16H,1,4,8,17H2,2H3/b25-16+ |
| InChIKey | KUKUOYJVQWWUOI-PCLIKHOPSA-N |
| XLogP | 5.07 |
| TPSA | 95.97 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 37 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 513.58 |
| LogP ≤ 5 | 5.07 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|