C23H13Cl2N3O4S — CID 124631443
(2Z)-2-[[3,5-dichloro-4-[(4-nitrophenyl)methoxy]phenyl]methylidene]-[1,3]thiazolo[3,2-a]benzimidazol-1-one (PubChem CID 124631443) has the molecular formula C23H13Cl2N3O4S and a molecular weight of 498.35 g/mol. Its IUPAC name is (2Z)-2-[[3,5-dichloro-4-[(4-nitrophenyl)methoxy]phenyl]methylidene]-[1,3]thiazolo[3,2-a]benzimidazol-1-one.
| Compound Name | (2Z)-2-[[3,5-dichloro-4-[(4-nitrophenyl)methoxy]phenyl]methylidene]-[1,3]thiazolo[3,2-a]benzimidazol-1-one |
|---|---|
| PubChem CID | 124631443 |
| Molecular Formula | C23H13Cl2N3O4S |
| Molecular Weight | 498.35 g/mol |
| Exact Mass | 497.00 |
| IUPAC Name | (2Z)-2-[[3,5-dichloro-4-[(4-nitrophenyl)methoxy]phenyl]methylidene]-[1,3]thiazolo[3,2-a]benzimidazol-1-one |
| SMILES | O=c1/c(=C/c2cc(Cl)c(OCc3ccc([N+](=O)[O-])cc3)c(Cl)c2)sc2nc3ccccc3n12 |
| InChI | InChI=1S/C23H13Cl2N3O4S/c24-16-9-14(10-17(25)21(16)32-12-13-5-7-15(8-6-13)28(30)31)11-20-22(29)27-19-4-2-1-3-18(19)26-23(27)33-20/h1-11H,12H2/b20-11- |
| InChIKey | RVNOHXOCWOLWAO-JAIQZWGSSA-N |
| XLogP | 5.25 |
| TPSA | 86.74 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 498.35 |
| LogP ≤ 5 | 5.25 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|