C23H14Br2ClN3O5 — CID 126078830
(5E)-3-(3-chlorophenyl)-5-[[3,5-dibromo-4-[(3-nitrophenyl)methoxy]phenyl]methylidene]imidazolidine-2,4-dione (PubChem CID 126078830) has the molecular formula C23H14Br2ClN3O5 and a molecular weight of 607.64 g/mol. Its IUPAC name is (5E)-3-(3-chlorophenyl)-5-[[3,5-dibromo-4-[(3-nitrophenyl)methoxy]phenyl]methylidene]imidazolidine-2,4-dione.
| Compound Name | (5E)-3-(3-chlorophenyl)-5-[[3,5-dibromo-4-[(3-nitrophenyl)methoxy]phenyl]methylidene]imidazolidine-2,4-dione |
|---|---|
| PubChem CID | 126078830 |
| Molecular Formula | C23H14Br2ClN3O5 |
| Molecular Weight | 607.64 g/mol |
| Exact Mass | 604.90 |
| IUPAC Name | (5E)-3-(3-chlorophenyl)-5-[[3,5-dibromo-4-[(3-nitrophenyl)methoxy]phenyl]methylidene]imidazolidine-2,4-dione |
| SMILES | O=C1N/C(=C/c2cc(Br)c(OCc3cccc([N+](=O)[O-])c3)c(Br)c2)C(=O)N1c1cccc(Cl)c1 |
| InChI | InChI=1S/C23H14Br2ClN3O5/c24-18-8-14(9-19(25)21(18)34-12-13-3-1-6-17(7-13)29(32)33)10-20-22(30)28(23(31)27-20)16-5-2-4-15(26)11-16/h1-11H,12H2,(H,27,31)/b20-10+ |
| InChIKey | NOWHMOZLBOYIAI-KEBDBYFISA-N |
| XLogP | 6.45 |
| TPSA | 101.78 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 34 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 607.64 |
| LogP ≤ 5 | 6.45 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'hydantoin', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|