C24H18Br2N2O3 — CID 3504062
5-[[3,5-dibromo-4-[(3-methylphenyl)methoxy]phenyl]methylidene]-3-phenylimidazolidine-2,4-dione (PubChem CID 3504062) has the molecular formula C24H18Br2N2O3 and a molecular weight of 542.23 g/mol. Its IUPAC name is 5-[[3,5-dibromo-4-[(3-methylphenyl)methoxy]phenyl]methylidene]-3-phenylimidazolidine-2,4-dione.
| Compound Name | 5-[[3,5-dibromo-4-[(3-methylphenyl)methoxy]phenyl]methylidene]-3-phenylimidazolidine-2,4-dione |
|---|---|
| PubChem CID | 3504062 |
| Molecular Formula | C24H18Br2N2O3 |
| Molecular Weight | 542.23 g/mol |
| Exact Mass | 539.97 |
| IUPAC Name | 5-[[3,5-dibromo-4-[(3-methylphenyl)methoxy]phenyl]methylidene]-3-phenylimidazolidine-2,4-dione |
| SMILES | Cc1cccc(COc2c(Br)cc(C=C3NC(=O)N(c4ccccc4)C3=O)cc2Br)c1 |
| InChI | InChI=1S/C24H18Br2N2O3/c1-15-6-5-7-16(10-15)14-31-22-19(25)11-17(12-20(22)26)13-21-23(29)28(24(30)27-21)18-8-3-2-4-9-18/h2-13H,14H2,1H3,(H,27,30) |
| InChIKey | CIHYSXLCOBVJCP-UHFFFAOYSA-N |
| XLogP | 6.20 |
| TPSA | 58.64 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 31 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 542.23 |
| LogP ≤ 5 | 6.20 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'hydantoin', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|