C25H26N2O6 — CID 3931279
methyl 2-[4-[(3-ethoxy-4-phenylmethoxy-5-prop-2-enylphenyl)methylidene]-2,5-dioxoimidazolidin-1-yl]acetate (PubChem CID 3931279) has the molecular formula C25H26N2O6 and a molecular weight of 450.49 g/mol. Its IUPAC name is methyl 2-[4-[(3-ethoxy-4-phenylmethoxy-5-prop-2-enylphenyl)methylidene]-2,5-dioxoimidazolidin-1-yl]acetate.
| Compound Name | methyl 2-[4-[(3-ethoxy-4-phenylmethoxy-5-prop-2-enylphenyl)methylidene]-2,5-dioxoimidazolidin-1-yl]acetate |
|---|---|
| PubChem CID | 3931279 |
| Molecular Formula | C25H26N2O6 |
| Molecular Weight | 450.49 g/mol |
| Exact Mass | 450.18 |
| IUPAC Name | methyl 2-[4-[(3-ethoxy-4-phenylmethoxy-5-prop-2-enylphenyl)methylidene]-2,5-dioxoimidazolidin-1-yl]acetate |
| SMILES | C=CCc1cc(C=C2NC(=O)N(CC(=O)OC)C2=O)cc(OCC)c1OCc1ccccc1 |
| InChI | InChI=1S/C25H26N2O6/c1-4-9-19-12-18(13-20-24(29)27(25(30)26-20)15-22(28)31-3)14-21(32-5-2)23(19)33-16-17-10-7-6-8-11-17/h4,6-8,10-14H,1,5,9,15-16H2,2-3H3,(H,26,30) |
| InChIKey | WTLHAKXFFKSXFX-UHFFFAOYSA-N |
| XLogP | 3.46 |
| TPSA | 94.17 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 450.49 |
| LogP ≤ 5 | 3.46 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'hydantoin', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|