C31H30FN3O5 — CID 126029521
2-[(4E)-4-[[3-ethoxy-4-[(2-fluorophenyl)methoxy]-5-prop-2-enylphenyl]methylidene]-2,5-dioxoimidazolidin-1-yl]-N-(4-methylphenyl)acetamide (PubChem CID 126029521) has the molecular formula C31H30FN3O5 and a molecular weight of 543.60 g/mol. Its IUPAC name is 2-[(4E)-4-[[3-ethoxy-4-[(2-fluorophenyl)methoxy]-5-prop-2-enylphenyl]methylidene]-2,5-dioxoimidazolidin-1-yl]-N-(4-methylphenyl)acetamide.
| Compound Name | 2-[(4E)-4-[[3-ethoxy-4-[(2-fluorophenyl)methoxy]-5-prop-2-enylphenyl]methylidene]-2,5-dioxoimidazolidin-1-yl]-N-(4-methylphenyl)acetamide |
|---|---|
| PubChem CID | 126029521 |
| Molecular Formula | C31H30FN3O5 |
| Molecular Weight | 543.60 g/mol |
| Exact Mass | 543.22 |
| IUPAC Name | 2-[(4E)-4-[[3-ethoxy-4-[(2-fluorophenyl)methoxy]-5-prop-2-enylphenyl]methylidene]-2,5-dioxoimidazolidin-1-yl]-N-(4-methylphenyl)acetamide |
| SMILES | C=CCc1cc(/C=C2/NC(=O)N(CC(=O)Nc3ccc(C)cc3)C2=O)cc(OCC)c1OCc1ccccc1F |
| InChI | InChI=1S/C31H30FN3O5/c1-4-8-22-15-21(17-27(39-5-2)29(22)40-19-23-9-6-7-10-25(23)32)16-26-30(37)35(31(38)34-26)18-28(36)33-24-13-11-20(3)12-14-24/h4,6-7,9-17H,1,5,8,18-19H2,2-3H3,(H,33,36)(H,34,38)/b26-16+ |
| InChIKey | ILDUCUCRLQBTSX-WGOQTCKBSA-N |
| XLogP | 5.37 |
| TPSA | 96.97 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 40 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 543.60 |
| LogP ≤ 5 | 5.37 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'hydantoin', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|