C22H20BrFN2O4 — CID 126154456
(5E)-5-[[3-bromo-5-ethoxy-4-[(2-fluorophenyl)methoxy]phenyl]methylidene]-3-prop-2-enylimidazolidine-2,4-dione (PubChem CID 126154456) has the molecular formula C22H20BrFN2O4 and a molecular weight of 475.31 g/mol. Its IUPAC name is (5E)-5-[[3-bromo-5-ethoxy-4-[(2-fluorophenyl)methoxy]phenyl]methylidene]-3-prop-2-enylimidazolidine-2,4-dione.
| Compound Name | (5E)-5-[[3-bromo-5-ethoxy-4-[(2-fluorophenyl)methoxy]phenyl]methylidene]-3-prop-2-enylimidazolidine-2,4-dione |
|---|---|
| PubChem CID | 126154456 |
| Molecular Formula | C22H20BrFN2O4 |
| Molecular Weight | 475.31 g/mol |
| Exact Mass | 474.06 |
| IUPAC Name | (5E)-5-[[3-bromo-5-ethoxy-4-[(2-fluorophenyl)methoxy]phenyl]methylidene]-3-prop-2-enylimidazolidine-2,4-dione |
| SMILES | C=CCN1C(=O)N/C(=C/c2cc(Br)c(OCc3ccccc3F)c(OCC)c2)C1=O |
| InChI | InChI=1S/C22H20BrFN2O4/c1-3-9-26-21(27)18(25-22(26)28)11-14-10-16(23)20(19(12-14)29-4-2)30-13-15-7-5-6-8-17(15)24/h3,5-8,10-12H,1,4,9,13H2,2H3,(H,25,28)/b18-11+ |
| InChIKey | OWGUMTLIBHTMMC-WOJGMQOQSA-N |
| XLogP | 4.64 |
| TPSA | 67.87 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 475.31 |
| LogP ≤ 5 | 4.64 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'hydantoin', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|