C22H19BrFNO3S2 — CID 94829767
(5E)-5-[[3-bromo-5-ethoxy-4-[(2-fluorophenyl)methoxy]phenyl]methylidene]-3-prop-2-enyl-2-sulfanylidene-1,3-thiazolidin-4-one (PubChem CID 94829767) has the molecular formula C22H19BrFNO3S2 and a molecular weight of 508.43 g/mol. Its IUPAC name is (5E)-5-[[3-bromo-5-ethoxy-4-[(2-fluorophenyl)methoxy]phenyl]methylidene]-3-prop-2-enyl-2-sulfanylidene-1,3-thiazolidin-4-one.
| Compound Name | (5E)-5-[[3-bromo-5-ethoxy-4-[(2-fluorophenyl)methoxy]phenyl]methylidene]-3-prop-2-enyl-2-sulfanylidene-1,3-thiazolidin-4-one |
|---|---|
| PubChem CID | 94829767 |
| Molecular Formula | C22H19BrFNO3S2 |
| Molecular Weight | 508.43 g/mol |
| Exact Mass | 507.00 |
| IUPAC Name | (5E)-5-[[3-bromo-5-ethoxy-4-[(2-fluorophenyl)methoxy]phenyl]methylidene]-3-prop-2-enyl-2-sulfanylidene-1,3-thiazolidin-4-one |
| SMILES | C=CCN1C(=O)/C(=C\c2cc(Br)c(OCc3ccccc3F)c(OCC)c2)SC1=S |
| InChI | InChI=1S/C22H19BrFNO3S2/c1-3-9-25-21(26)19(30-22(25)29)12-14-10-16(23)20(18(11-14)27-4-2)28-13-15-7-5-6-8-17(15)24/h3,5-8,10-12H,1,4,9,13H2,2H3/b19-12+ |
| InChIKey | WXZAOVBKNKEGJJ-XDHOZWIPSA-N |
| XLogP | 5.95 |
| TPSA | 38.77 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 30 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 508.43 |
| LogP ≤ 5 | 5.95 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'ene_rhod_A(235)', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|