C22H21FN2O4 — CID 126133264
(5E)-5-[[3-ethoxy-4-[(2-fluorophenyl)methoxy]phenyl]methylidene]-3-prop-2-enylimidazolidine-2,4-dione (PubChem CID 126133264) has the molecular formula C22H21FN2O4 and a molecular weight of 396.42 g/mol. Its IUPAC name is (5E)-5-[[3-ethoxy-4-[(2-fluorophenyl)methoxy]phenyl]methylidene]-3-prop-2-enylimidazolidine-2,4-dione.
| Compound Name | (5E)-5-[[3-ethoxy-4-[(2-fluorophenyl)methoxy]phenyl]methylidene]-3-prop-2-enylimidazolidine-2,4-dione |
|---|---|
| PubChem CID | 126133264 |
| Molecular Formula | C22H21FN2O4 |
| Molecular Weight | 396.42 g/mol |
| Exact Mass | 396.15 |
| IUPAC Name | (5E)-5-[[3-ethoxy-4-[(2-fluorophenyl)methoxy]phenyl]methylidene]-3-prop-2-enylimidazolidine-2,4-dione |
| SMILES | C=CCN1C(=O)N/C(=C/c2ccc(OCc3ccccc3F)c(OCC)c2)C1=O |
| InChI | InChI=1S/C22H21FN2O4/c1-3-11-25-21(26)18(24-22(25)27)12-15-9-10-19(20(13-15)28-4-2)29-14-16-7-5-6-8-17(16)23/h3,5-10,12-13H,1,4,11,14H2,2H3,(H,24,27)/b18-12+ |
| InChIKey | IGXLWFKILORWEX-LDADJPATSA-N |
| XLogP | 3.88 |
| TPSA | 67.87 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 396.42 |
| LogP ≤ 5 | 3.88 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'hydantoin', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|