C25H23BrN2O4 — CID 126174202
(5E)-5-[[3-bromo-5-ethoxy-4-(naphthalen-1-ylmethoxy)phenyl]methylidene]-3-ethylimidazolidine-2,4-dione (PubChem CID 126174202) has the molecular formula C25H23BrN2O4 and a molecular weight of 495.37 g/mol. Its IUPAC name is (5E)-5-[[3-bromo-5-ethoxy-4-(naphthalen-1-ylmethoxy)phenyl]methylidene]-3-ethylimidazolidine-2,4-dione.
| Compound Name | (5E)-5-[[3-bromo-5-ethoxy-4-(naphthalen-1-ylmethoxy)phenyl]methylidene]-3-ethylimidazolidine-2,4-dione |
|---|---|
| PubChem CID | 126174202 |
| Molecular Formula | C25H23BrN2O4 |
| Molecular Weight | 495.37 g/mol |
| Exact Mass | 494.08 |
| IUPAC Name | (5E)-5-[[3-bromo-5-ethoxy-4-(naphthalen-1-ylmethoxy)phenyl]methylidene]-3-ethylimidazolidine-2,4-dione |
| SMILES | CCOc1cc(/C=C2/NC(=O)N(CC)C2=O)cc(Br)c1OCc1cccc2ccccc12 |
| InChI | InChI=1S/C25H23BrN2O4/c1-3-28-24(29)21(27-25(28)30)13-16-12-20(26)23(22(14-16)31-4-2)32-15-18-10-7-9-17-8-5-6-11-19(17)18/h5-14H,3-4,15H2,1-2H3,(H,27,30)/b21-13+ |
| InChIKey | PAAWXAJNPXHIMJ-FYJGNVAPSA-N |
| XLogP | 5.49 |
| TPSA | 67.87 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 495.37 |
| LogP ≤ 5 | 5.49 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'hydantoin', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|