C29H22BrFN2O4 — CID 126024001
(5Z)-5-[[3-bromo-5-methoxy-4-(naphthalen-1-ylmethoxy)phenyl]methylidene]-3-[(4-fluorophenyl)methyl]imidazolidine-2,4-dione (PubChem CID 126024001) has the molecular formula C29H22BrFN2O4 and a molecular weight of 561.41 g/mol. Its IUPAC name is (5Z)-5-[[3-bromo-5-methoxy-4-(naphthalen-1-ylmethoxy)phenyl]methylidene]-3-[(4-fluorophenyl)methyl]imidazolidine-2,4-dione.
| Compound Name | (5Z)-5-[[3-bromo-5-methoxy-4-(naphthalen-1-ylmethoxy)phenyl]methylidene]-3-[(4-fluorophenyl)methyl]imidazolidine-2,4-dione |
|---|---|
| PubChem CID | 126024001 |
| Molecular Formula | C29H22BrFN2O4 |
| Molecular Weight | 561.41 g/mol |
| Exact Mass | 560.07 |
| IUPAC Name | (5Z)-5-[[3-bromo-5-methoxy-4-(naphthalen-1-ylmethoxy)phenyl]methylidene]-3-[(4-fluorophenyl)methyl]imidazolidine-2,4-dione |
| SMILES | COc1cc(/C=C2\NC(=O)N(Cc3ccc(F)cc3)C2=O)cc(Br)c1OCc1cccc2ccccc12 |
| InChI | InChI=1S/C29H22BrFN2O4/c1-36-26-15-19(14-25-28(34)33(29(35)32-25)16-18-9-11-22(31)12-10-18)13-24(30)27(26)37-17-21-7-4-6-20-5-2-3-8-23(20)21/h2-15H,16-17H2,1H3,(H,32,35)/b25-14- |
| InChIKey | WLOGEMUROIAULT-QFEZKATASA-N |
| XLogP | 6.42 |
| TPSA | 67.87 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 37 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 561.41 |
| LogP ≤ 5 | 6.42 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'hydantoin', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|