C26H20N4O10 — CID 126097154
(5E)-5-[[4-(2,4-dinitrophenoxy)-3-ethoxyphenyl]methylidene]-1-(4-methoxyphenyl)-1,3-diazinane-2,4,6-trione (PubChem CID 126097154) has the molecular formula C26H20N4O10 and a molecular weight of 548.46 g/mol. Its IUPAC name is (5E)-5-[[4-(2,4-dinitrophenoxy)-3-ethoxyphenyl]methylidene]-1-(4-methoxyphenyl)-1,3-diazinane-2,4,6-trione.
| Compound Name | (5E)-5-[[4-(2,4-dinitrophenoxy)-3-ethoxyphenyl]methylidene]-1-(4-methoxyphenyl)-1,3-diazinane-2,4,6-trione |
|---|---|
| PubChem CID | 126097154 |
| Molecular Formula | C26H20N4O10 |
| Molecular Weight | 548.46 g/mol |
| Exact Mass | 548.12 |
| IUPAC Name | (5E)-5-[[4-(2,4-dinitrophenoxy)-3-ethoxyphenyl]methylidene]-1-(4-methoxyphenyl)-1,3-diazinane-2,4,6-trione |
| SMILES | CCOc1cc(/C=C2\C(=O)NC(=O)N(c3ccc(OC)cc3)C2=O)ccc1Oc1ccc([N+](=O)[O-])cc1[N+](=O)[O-] |
| InChI | InChI=1S/C26H20N4O10/c1-3-39-23-13-15(4-10-22(23)40-21-11-7-17(29(34)35)14-20(21)30(36)37)12-19-24(31)27-26(33)28(25(19)32)16-5-8-18(38-2)9-6-16/h4-14H,3H2,1-2H3,(H,27,31,33)/b19-12+ |
| InChIKey | QGWMPDMGTSOMSU-XDHOZWIPSA-N |
| XLogP | 4.37 |
| TPSA | 180.45 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 40 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 548.46 |
| LogP ≤ 5 | 4.37 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'ene_six_het_A(483)', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_4', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|