C24H14Cl2N4O9 — CID 126082941
(5E)-5-[[3,5-dichloro-4-(2,4-dinitrophenoxy)phenyl]methylidene]-1-(4-methoxyphenyl)-1,3-diazinane-2,4,6-trione (PubChem CID 126082941) has the molecular formula C24H14Cl2N4O9 and a molecular weight of 573.30 g/mol. Its IUPAC name is (5E)-5-[[3,5-dichloro-4-(2,4-dinitrophenoxy)phenyl]methylidene]-1-(4-methoxyphenyl)-1,3-diazinane-2,4,6-trione.
| Compound Name | (5E)-5-[[3,5-dichloro-4-(2,4-dinitrophenoxy)phenyl]methylidene]-1-(4-methoxyphenyl)-1,3-diazinane-2,4,6-trione |
|---|---|
| PubChem CID | 126082941 |
| Molecular Formula | C24H14Cl2N4O9 |
| Molecular Weight | 573.30 g/mol |
| Exact Mass | 572.01 |
| IUPAC Name | (5E)-5-[[3,5-dichloro-4-(2,4-dinitrophenoxy)phenyl]methylidene]-1-(4-methoxyphenyl)-1,3-diazinane-2,4,6-trione |
| SMILES | COc1ccc(N2C(=O)NC(=O)/C(=C\c3cc(Cl)c(Oc4ccc([N+](=O)[O-])cc4[N+](=O)[O-])c(Cl)c3)C2=O)cc1 |
| InChI | InChI=1S/C24H14Cl2N4O9/c1-38-15-5-2-13(3-6-15)28-23(32)16(22(31)27-24(28)33)8-12-9-17(25)21(18(26)10-12)39-20-7-4-14(29(34)35)11-19(20)30(36)37/h2-11H,1H3,(H,27,31,33)/b16-8+ |
| InChIKey | BNXHBPXNHFKOHH-LZYBPNLTSA-N |
| XLogP | 5.28 |
| TPSA | 171.22 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 39 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 573.30 |
| LogP ≤ 5 | 5.28 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'ene_six_het_A(483)', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_4', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|