C26H16BrClF3N3O7 — CID 126087125
(5E)-1-(4-bromophenyl)-5-[[3-chloro-5-ethoxy-4-[2-nitro-4-(trifluoromethyl)phenoxy]phenyl]methylidene]-1,3-diazinane-2,4,6-trione (PubChem CID 126087125) has the molecular formula C26H16BrClF3N3O7 and a molecular weight of 654.78 g/mol. Its IUPAC name is (5E)-1-(4-bromophenyl)-5-[[3-chloro-5-ethoxy-4-[2-nitro-4-(trifluoromethyl)phenoxy]phenyl]methylidene]-1,3-diazinane-2,4,6-trione.
| Compound Name | (5E)-1-(4-bromophenyl)-5-[[3-chloro-5-ethoxy-4-[2-nitro-4-(trifluoromethyl)phenoxy]phenyl]methylidene]-1,3-diazinane-2,4,6-trione |
|---|---|
| PubChem CID | 126087125 |
| Molecular Formula | C26H16BrClF3N3O7 |
| Molecular Weight | 654.78 g/mol |
| Exact Mass | 652.98 |
| IUPAC Name | (5E)-1-(4-bromophenyl)-5-[[3-chloro-5-ethoxy-4-[2-nitro-4-(trifluoromethyl)phenoxy]phenyl]methylidene]-1,3-diazinane-2,4,6-trione |
| SMILES | CCOc1cc(/C=C2\C(=O)NC(=O)N(c3ccc(Br)cc3)C2=O)cc(Cl)c1Oc1ccc(C(F)(F)F)cc1[N+](=O)[O-] |
| InChI | InChI=1S/C26H16BrClF3N3O7/c1-2-40-21-11-13(9-17-23(35)32-25(37)33(24(17)36)16-6-4-15(27)5-7-16)10-18(28)22(21)41-20-8-3-14(26(29,30)31)12-19(20)34(38)39/h3-12H,2H2,1H3,(H,32,35,37)/b17-9+ |
| InChIKey | MQVHHQWVVVMEJA-RQZCQDPDSA-N |
| XLogP | 6.89 |
| TPSA | 128.08 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 41 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 654.78 |
| LogP ≤ 5 | 6.89 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'ene_six_het_A(483)', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_4', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|