C23H11Cl2N5O10 — CID 126099472
(5E)-5-[[3,5-dichloro-2-(2,4-dinitrophenoxy)phenyl]methylidene]-1-(4-nitrophenyl)-1,3-diazinane-2,4,6-trione (PubChem CID 126099472) has the molecular formula C23H11Cl2N5O10 and a molecular weight of 588.27 g/mol. Its IUPAC name is (5E)-5-[[3,5-dichloro-2-(2,4-dinitrophenoxy)phenyl]methylidene]-1-(4-nitrophenyl)-1,3-diazinane-2,4,6-trione.
| Compound Name | (5E)-5-[[3,5-dichloro-2-(2,4-dinitrophenoxy)phenyl]methylidene]-1-(4-nitrophenyl)-1,3-diazinane-2,4,6-trione |
|---|---|
| PubChem CID | 126099472 |
| Molecular Formula | C23H11Cl2N5O10 |
| Molecular Weight | 588.27 g/mol |
| Exact Mass | 586.99 |
| IUPAC Name | (5E)-5-[[3,5-dichloro-2-(2,4-dinitrophenoxy)phenyl]methylidene]-1-(4-nitrophenyl)-1,3-diazinane-2,4,6-trione |
| SMILES | O=C1NC(=O)N(c2ccc([N+](=O)[O-])cc2)C(=O)/C1=C/c1cc(Cl)cc(Cl)c1Oc1ccc([N+](=O)[O-])cc1[N+](=O)[O-] |
| InChI | InChI=1S/C23H11Cl2N5O10/c24-12-7-11(20(17(25)9-12)40-19-6-5-15(29(36)37)10-18(19)30(38)39)8-16-21(31)26-23(33)27(22(16)32)13-1-3-14(4-2-13)28(34)35/h1-10H,(H,26,31,33)/b16-8+ |
| InChIKey | XRKWCXJRFVHABV-LZYBPNLTSA-N |
| XLogP | 5.18 |
| TPSA | 205.13 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 40 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 588.27 |
| LogP ≤ 5 | 5.18 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'ene_six_het_A(483)', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_4', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|