C23H13BrN4O8 — CID 126084118
(5E)-1-(4-bromophenyl)-5-[[2-(2,4-dinitrophenoxy)phenyl]methylidene]-1,3-diazinane-2,4,6-trione (PubChem CID 126084118) has the molecular formula C23H13BrN4O8 and a molecular weight of 553.28 g/mol. Its IUPAC name is (5E)-1-(4-bromophenyl)-5-[[2-(2,4-dinitrophenoxy)phenyl]methylidene]-1,3-diazinane-2,4,6-trione.
| Compound Name | (5E)-1-(4-bromophenyl)-5-[[2-(2,4-dinitrophenoxy)phenyl]methylidene]-1,3-diazinane-2,4,6-trione |
|---|---|
| PubChem CID | 126084118 |
| Molecular Formula | C23H13BrN4O8 |
| Molecular Weight | 553.28 g/mol |
| Exact Mass | 551.99 |
| IUPAC Name | (5E)-1-(4-bromophenyl)-5-[[2-(2,4-dinitrophenoxy)phenyl]methylidene]-1,3-diazinane-2,4,6-trione |
| SMILES | O=C1NC(=O)N(c2ccc(Br)cc2)C(=O)/C1=C/c1ccccc1Oc1ccc([N+](=O)[O-])cc1[N+](=O)[O-] |
| InChI | InChI=1S/C23H13BrN4O8/c24-14-5-7-15(8-6-14)26-22(30)17(21(29)25-23(26)31)11-13-3-1-2-4-19(13)36-20-10-9-16(27(32)33)12-18(20)28(34)35/h1-12H,(H,25,29,31)/b17-11+ |
| InChIKey | GAISLLWZIGVCBH-GZTJUZNOSA-N |
| XLogP | 4.72 |
| TPSA | 161.99 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 553.28 |
| LogP ≤ 5 | 4.72 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'ene_six_het_A(483)', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_4', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|