C29H16Br2N4O8 — CID 126090410
5-[[3,5-dibromo-2-(2,4-dinitrophenoxy)phenyl]methylidene]-1,3-diphenyl-1,3-diazinane-2,4,6-trione (PubChem CID 126090410) has the molecular formula C29H16Br2N4O8 and a molecular weight of 708.28 g/mol. Its IUPAC name is 5-[[3,5-dibromo-2-(2,4-dinitrophenoxy)phenyl]methylidene]-1,3-diphenyl-1,3-diazinane-2,4,6-trione.
| Compound Name | 5-[[3,5-dibromo-2-(2,4-dinitrophenoxy)phenyl]methylidene]-1,3-diphenyl-1,3-diazinane-2,4,6-trione |
|---|---|
| PubChem CID | 126090410 |
| Molecular Formula | C29H16Br2N4O8 |
| Molecular Weight | 708.28 g/mol |
| Exact Mass | 705.93 |
| IUPAC Name | 5-[[3,5-dibromo-2-(2,4-dinitrophenoxy)phenyl]methylidene]-1,3-diphenyl-1,3-diazinane-2,4,6-trione |
| SMILES | O=C1C(=Cc2cc(Br)cc(Br)c2Oc2ccc([N+](=O)[O-])cc2[N+](=O)[O-])C(=O)N(c2ccccc2)C(=O)N1c1ccccc1 |
| InChI | InChI=1S/C29H16Br2N4O8/c30-18-13-17(26(23(31)15-18)43-25-12-11-21(34(39)40)16-24(25)35(41)42)14-22-27(36)32(19-7-3-1-4-8-19)29(38)33(28(22)37)20-9-5-2-6-10-20/h1-16H |
| InChIKey | WTCGZZBDELRESE-UHFFFAOYSA-N |
| XLogP | 7.40 |
| TPSA | 153.20 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 43 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 708.28 |
| LogP ≤ 5 | 7.40 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'ene_six_het_A(483)', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_4', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|