C30H18F3N3O6 — CID 126088650
5-[[2-[2-nitro-4-(trifluoromethyl)phenoxy]phenyl]methylidene]-1,3-diphenyl-1,3-diazinane-2,4,6-trione (PubChem CID 126088650) has the molecular formula C30H18F3N3O6 and a molecular weight of 573.48 g/mol. Its IUPAC name is 5-[[2-[2-nitro-4-(trifluoromethyl)phenoxy]phenyl]methylidene]-1,3-diphenyl-1,3-diazinane-2,4,6-trione.
| Compound Name | 5-[[2-[2-nitro-4-(trifluoromethyl)phenoxy]phenyl]methylidene]-1,3-diphenyl-1,3-diazinane-2,4,6-trione |
|---|---|
| PubChem CID | 126088650 |
| Molecular Formula | C30H18F3N3O6 |
| Molecular Weight | 573.48 g/mol |
| Exact Mass | 573.11 |
| IUPAC Name | 5-[[2-[2-nitro-4-(trifluoromethyl)phenoxy]phenyl]methylidene]-1,3-diphenyl-1,3-diazinane-2,4,6-trione |
| SMILES | O=C1C(=Cc2ccccc2Oc2ccc(C(F)(F)F)cc2[N+](=O)[O-])C(=O)N(c2ccccc2)C(=O)N1c1ccccc1 |
| InChI | InChI=1S/C30H18F3N3O6/c31-30(32,33)20-15-16-26(24(18-20)36(40)41)42-25-14-8-7-9-19(25)17-23-27(37)34(21-10-3-1-4-11-21)29(39)35(28(23)38)22-12-5-2-6-13-22/h1-18H |
| InChIKey | PQHUOEHYASXQKX-UHFFFAOYSA-N |
| XLogP | 6.99 |
| TPSA | 110.06 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 42 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 573.48 |
| LogP ≤ 5 | 6.99 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'ene_six_het_A(483)', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_4', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|