C19H13BrN4O7 — CID 126234100
2-[4-bromo-2-[(E)-[1-(4-nitrophenyl)-2,4,6-trioxo-1,3-diazinan-5-ylidene]methyl]phenoxy]acetamide (PubChem CID 126234100) has the molecular formula C19H13BrN4O7 and a molecular weight of 489.24 g/mol. Its IUPAC name is 2-[4-bromo-2-[(E)-[1-(4-nitrophenyl)-2,4,6-trioxo-1,3-diazinan-5-ylidene]methyl]phenoxy]acetamide.
| Compound Name | 2-[4-bromo-2-[(E)-[1-(4-nitrophenyl)-2,4,6-trioxo-1,3-diazinan-5-ylidene]methyl]phenoxy]acetamide |
|---|---|
| PubChem CID | 126234100 |
| Molecular Formula | C19H13BrN4O7 |
| Molecular Weight | 489.24 g/mol |
| Exact Mass | 488.00 |
| IUPAC Name | 2-[4-bromo-2-[(E)-[1-(4-nitrophenyl)-2,4,6-trioxo-1,3-diazinan-5-ylidene]methyl]phenoxy]acetamide |
| SMILES | NC(=O)COc1ccc(Br)cc1/C=C1\C(=O)NC(=O)N(c2ccc([N+](=O)[O-])cc2)C1=O |
| InChI | InChI=1S/C19H13BrN4O7/c20-11-1-6-15(31-9-16(21)25)10(7-11)8-14-17(26)22-19(28)23(18(14)27)12-2-4-13(5-3-12)24(29)30/h1-8H,9H2,(H2,21,25)(H,22,26,28)/b14-8+ |
| InChIKey | XDYMJMHIELSICN-RIYZIHGNSA-N |
| XLogP | 1.89 |
| TPSA | 161.94 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 489.24 |
| LogP ≤ 5 | 1.89 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'ene_six_het_A(483)', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_4', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|