C20H15BrN2O6 — CID 1368305
2-[4-bromo-2-[[1-(4-methylphenyl)-2,4,6-trioxo-1,3-diazinan-5-ylidene]methyl]phenoxy]acetic acid (PubChem CID 1368305) has the molecular formula C20H15BrN2O6 and a molecular weight of 459.25 g/mol. Its IUPAC name is 2-[4-bromo-2-[[1-(4-methylphenyl)-2,4,6-trioxo-1,3-diazinan-5-ylidene]methyl]phenoxy]acetic acid.
| Compound Name | 2-[4-bromo-2-[[1-(4-methylphenyl)-2,4,6-trioxo-1,3-diazinan-5-ylidene]methyl]phenoxy]acetic acid |
|---|---|
| PubChem CID | 1368305 |
| Molecular Formula | C20H15BrN2O6 |
| Molecular Weight | 459.25 g/mol |
| Exact Mass | 458.01 |
| IUPAC Name | 2-[4-bromo-2-[[1-(4-methylphenyl)-2,4,6-trioxo-1,3-diazinan-5-ylidene]methyl]phenoxy]acetic acid |
| SMILES | Cc1ccc(N2C(=O)NC(=O)C(=Cc3cc(Br)ccc3OCC(=O)O)C2=O)cc1 |
| InChI | InChI=1S/C20H15BrN2O6/c1-11-2-5-14(6-3-11)23-19(27)15(18(26)22-20(23)28)9-12-8-13(21)4-7-16(12)29-10-17(24)25/h2-9H,10H2,1H3,(H,24,25)(H,22,26,28) |
| InChIKey | PAKBMMARPIWPLP-UHFFFAOYSA-N |
| XLogP | 2.89 |
| TPSA | 113.01 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 459.25 |
| LogP ≤ 5 | 2.89 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'ene_six_het_A(483)', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_4', 'substructure': 'N/A'} |
|---|