C19H12BrClN2O6 — CID 126051682
2-[2-[(E)-[1-(4-bromophenyl)-2,4,6-trioxo-1,3-diazinan-5-ylidene]methyl]-4-chlorophenoxy]acetic acid (PubChem CID 126051682) has the molecular formula C19H12BrClN2O6 and a molecular weight of 479.67 g/mol. Its IUPAC name is 2-[2-[(E)-[1-(4-bromophenyl)-2,4,6-trioxo-1,3-diazinan-5-ylidene]methyl]-4-chlorophenoxy]acetic acid.
| Compound Name | 2-[2-[(E)-[1-(4-bromophenyl)-2,4,6-trioxo-1,3-diazinan-5-ylidene]methyl]-4-chlorophenoxy]acetic acid |
|---|---|
| PubChem CID | 126051682 |
| Molecular Formula | C19H12BrClN2O6 |
| Molecular Weight | 479.67 g/mol |
| Exact Mass | 477.96 |
| IUPAC Name | 2-[2-[(E)-[1-(4-bromophenyl)-2,4,6-trioxo-1,3-diazinan-5-ylidene]methyl]-4-chlorophenoxy]acetic acid |
| SMILES | O=C(O)COc1ccc(Cl)cc1/C=C1\C(=O)NC(=O)N(c2ccc(Br)cc2)C1=O |
| InChI | InChI=1S/C19H12BrClN2O6/c20-11-1-4-13(5-2-11)23-18(27)14(17(26)22-19(23)28)8-10-7-12(21)3-6-15(10)29-9-16(24)25/h1-8H,9H2,(H,24,25)(H,22,26,28)/b14-8+ |
| InChIKey | IHFIYMVVPXCOBM-RIYZIHGNSA-N |
| XLogP | 3.23 |
| TPSA | 113.01 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 479.67 |
| LogP ≤ 5 | 3.23 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'ene_six_het_A(483)', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_4', 'substructure': 'N/A'} |
|---|