C20H14Cl2N2O6 — CID 2179226
2-[4-chloro-2-[(E)-[1-(5-chloro-2-methylphenyl)-2,4,6-trioxo-1,3-diazinan-5-ylidene]methyl]phenoxy]acetic acid (PubChem CID 2179226) has the molecular formula C20H14Cl2N2O6 and a molecular weight of 449.25 g/mol. Its IUPAC name is 2-[4-chloro-2-[(E)-[1-(5-chloro-2-methylphenyl)-2,4,6-trioxo-1,3-diazinan-5-ylidene]methyl]phenoxy]acetic acid.
| Compound Name | 2-[4-chloro-2-[(E)-[1-(5-chloro-2-methylphenyl)-2,4,6-trioxo-1,3-diazinan-5-ylidene]methyl]phenoxy]acetic acid |
|---|---|
| PubChem CID | 2179226 |
| Molecular Formula | C20H14Cl2N2O6 |
| Molecular Weight | 449.25 g/mol |
| Exact Mass | 448.02 |
| IUPAC Name | 2-[4-chloro-2-[(E)-[1-(5-chloro-2-methylphenyl)-2,4,6-trioxo-1,3-diazinan-5-ylidene]methyl]phenoxy]acetic acid |
| SMILES | Cc1ccc(Cl)cc1N1C(=O)NC(=O)/C(=C\c2cc(Cl)ccc2OCC(=O)O)C1=O |
| InChI | InChI=1S/C20H14Cl2N2O6/c1-10-2-3-13(22)8-15(10)24-19(28)14(18(27)23-20(24)29)7-11-6-12(21)4-5-16(11)30-9-17(25)26/h2-8H,9H2,1H3,(H,25,26)(H,23,27,29)/b14-7+ |
| InChIKey | KFFXZMQFCWSHLT-VGOFMYFVSA-N |
| XLogP | 3.43 |
| TPSA | 113.01 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 449.25 |
| LogP ≤ 5 | 3.43 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'ene_six_het_A(483)', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_4', 'substructure': 'N/A'} |
|---|