C24H14Cl2N4O8 — CID 126099792
(5E)-5-[[5-chloro-2-(2,4-dinitrophenoxy)phenyl]methylidene]-1-(3-chloro-2-methylphenyl)-1,3-diazinane-2,4,6-trione (PubChem CID 126099792) has the molecular formula C24H14Cl2N4O8 and a molecular weight of 557.30 g/mol. Its IUPAC name is (5E)-5-[[5-chloro-2-(2,4-dinitrophenoxy)phenyl]methylidene]-1-(3-chloro-2-methylphenyl)-1,3-diazinane-2,4,6-trione.
| Compound Name | (5E)-5-[[5-chloro-2-(2,4-dinitrophenoxy)phenyl]methylidene]-1-(3-chloro-2-methylphenyl)-1,3-diazinane-2,4,6-trione |
|---|---|
| PubChem CID | 126099792 |
| Molecular Formula | C24H14Cl2N4O8 |
| Molecular Weight | 557.30 g/mol |
| Exact Mass | 556.02 |
| IUPAC Name | (5E)-5-[[5-chloro-2-(2,4-dinitrophenoxy)phenyl]methylidene]-1-(3-chloro-2-methylphenyl)-1,3-diazinane-2,4,6-trione |
| SMILES | Cc1c(Cl)cccc1N1C(=O)NC(=O)/C(=C\c2cc(Cl)ccc2Oc2ccc([N+](=O)[O-])cc2[N+](=O)[O-])C1=O |
| InChI | InChI=1S/C24H14Cl2N4O8/c1-12-17(26)3-2-4-18(12)28-23(32)16(22(31)27-24(28)33)10-13-9-14(25)5-7-20(13)38-21-8-6-15(29(34)35)11-19(21)30(36)37/h2-11H,1H3,(H,27,31,33)/b16-10+ |
| InChIKey | ZDXQEXPQGMYMTG-MHWRWJLKSA-N |
| XLogP | 5.58 |
| TPSA | 161.99 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 557.30 |
| LogP ≤ 5 | 5.58 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'ene_six_het_A(483)', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_4', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|