C19H11ClF3N3O7 — CID 6845221
1-[2-chloro-5-(trifluoromethyl)phenyl]-5-[(4-hydroxy-3-methoxy-5-nitrophenyl)methylidene]-1,3-diazinane-2,4,6-trione (PubChem CID 6845221) has the molecular formula C19H11ClF3N3O7 and a molecular weight of 485.76 g/mol. Its IUPAC name is 1-[2-chloro-5-(trifluoromethyl)phenyl]-5-[(4-hydroxy-3-methoxy-5-nitrophenyl)methylidene]-1,3-diazinane-2,4,6-trione.
| Compound Name | 1-[2-chloro-5-(trifluoromethyl)phenyl]-5-[(4-hydroxy-3-methoxy-5-nitrophenyl)methylidene]-1,3-diazinane-2,4,6-trione |
|---|---|
| PubChem CID | 6845221 |
| Molecular Formula | C19H11ClF3N3O7 |
| Molecular Weight | 485.76 g/mol |
| Exact Mass | 485.02 |
| IUPAC Name | 1-[2-chloro-5-(trifluoromethyl)phenyl]-5-[(4-hydroxy-3-methoxy-5-nitrophenyl)methylidene]-1,3-diazinane-2,4,6-trione |
| SMILES | COc1cc(C=C2C(=O)NC(=O)N(c3cc(C(F)(F)F)ccc3Cl)C2=O)cc([N+](=O)[O-])c1O |
| InChI | InChI=1S/C19H11ClF3N3O7/c1-33-14-6-8(5-13(15(14)27)26(31)32)4-10-16(28)24-18(30)25(17(10)29)12-7-9(19(21,22)23)2-3-11(12)20/h2-7,27H,1H3,(H,24,28,30) |
| InChIKey | XHVZITTZIUSXCF-UHFFFAOYSA-N |
| XLogP | 3.65 |
| TPSA | 139.08 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 485.76 |
| LogP ≤ 5 | 3.65 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'ene_six_het_A(483)', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_4', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|