C14H14N2S — CID 139315217
(E)-2-(1,3-benzothiazol-2-yl)-4,4-dimethylpent-2-enenitrile (PubChem CID 139315217) has the molecular formula C14H14N2S and a molecular weight of 242.35 g/mol. Its IUPAC name is (E)-2-(1,3-benzothiazol-2-yl)-4,4-dimethylpent-2-enenitrile.
| Compound Name | (E)-2-(1,3-benzothiazol-2-yl)-4,4-dimethylpent-2-enenitrile |
|---|---|
| PubChem CID | 139315217 |
| Molecular Formula | C14H14N2S |
| Molecular Weight | 242.35 g/mol |
| Exact Mass | 242.09 |
| IUPAC Name | (E)-2-(1,3-benzothiazol-2-yl)-4,4-dimethylpent-2-enenitrile |
| SMILES | CC(C)(C)/C=C(\C#N)c1nc2ccccc2s1 |
| InChI | InChI=1S/C14H14N2S/c1-14(2,3)8-10(9-15)13-16-11-6-4-5-7-12(11)17-13/h4-8H,1-3H3/b10-8+ |
| InChIKey | MSPCQUIGXBELNX-CSKARUKUSA-N |
| XLogP | 4.25 |
| TPSA | 36.68 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 242.35 |
| LogP ≤ 5 | 4.25 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'conjugated_nitrile_group', 'substructure': 'N/A'} |
|---|