C12H9N3S2 — CID 3705544
N-[2-(1,3-benzothiazol-2-yl)-2-cyanoethenyl]ethanethioamide (PubChem CID 3705544) has the molecular formula C12H9N3S2 and a molecular weight of 259.36 g/mol. Its IUPAC name is N-[2-(1,3-benzothiazol-2-yl)-2-cyanoethenyl]ethanethioamide.
| Compound Name | N-[2-(1,3-benzothiazol-2-yl)-2-cyanoethenyl]ethanethioamide |
|---|---|
| PubChem CID | 3705544 |
| Molecular Formula | C12H9N3S2 |
| Molecular Weight | 259.36 g/mol |
| Exact Mass | 259.02 |
| IUPAC Name | N-[2-(1,3-benzothiazol-2-yl)-2-cyanoethenyl]ethanethioamide |
| SMILES | CC(=S)NC=C(C#N)c1nc2ccccc2s1 |
| InChI | InChI=1S/C12H9N3S2/c1-8(16)14-7-9(6-13)12-15-10-4-2-3-5-11(10)17-12/h2-5,7H,1H3,(H,14,16) |
| InChIKey | AKAWTXVMGNKRGB-UHFFFAOYSA-N |
| XLogP | 3.10 |
| TPSA | 48.71 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 259.36 |
| LogP ≤ 5 | 3.10 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'conjugated_nitrile_group', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|