C19H16N2S — CID 17365782
(Z)-2-(1,3-benzothiazol-2-yl)-3-(4-propan-2-ylphenyl)prop-2-enenitrile (PubChem CID 17365782) has the molecular formula C19H16N2S and a molecular weight of 304.42 g/mol. Its IUPAC name is (Z)-2-(1,3-benzothiazol-2-yl)-3-(4-propan-2-ylphenyl)prop-2-enenitrile.
| Compound Name | (Z)-2-(1,3-benzothiazol-2-yl)-3-(4-propan-2-ylphenyl)prop-2-enenitrile |
|---|---|
| PubChem CID | 17365782 |
| Molecular Formula | C19H16N2S |
| Molecular Weight | 304.42 g/mol |
| Exact Mass | 304.10 |
| IUPAC Name | (Z)-2-(1,3-benzothiazol-2-yl)-3-(4-propan-2-ylphenyl)prop-2-enenitrile |
| SMILES | CC(C)c1ccc(/C=C(/C#N)c2nc3ccccc3s2)cc1 |
| InChI | InChI=1S/C19H16N2S/c1-13(2)15-9-7-14(8-10-15)11-16(12-20)19-21-17-5-3-4-6-18(17)22-19/h3-11,13H,1-2H3/b16-11- |
| InChIKey | VQPQQCGFGIYLFE-WJDWOHSUSA-N |
| XLogP | 5.48 |
| TPSA | 36.68 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 22 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 304.42 |
| LogP ≤ 5 | 5.48 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'conjugated_nitrile_group', 'substructure': 'N/A'} |
|---|