C18H13N3O2S — CID 17385722
2-[4-[(E)-2-(1,3-benzothiazol-2-yl)-2-cyanoethenyl]phenoxy]acetamide (PubChem CID 17385722) has the molecular formula C18H13N3O2S and a molecular weight of 335.39 g/mol. Its IUPAC name is 2-[4-[(E)-2-(1,3-benzothiazol-2-yl)-2-cyanoethenyl]phenoxy]acetamide.
| Compound Name | 2-[4-[(E)-2-(1,3-benzothiazol-2-yl)-2-cyanoethenyl]phenoxy]acetamide |
|---|---|
| PubChem CID | 17385722 |
| Molecular Formula | C18H13N3O2S |
| Molecular Weight | 335.39 g/mol |
| Exact Mass | 335.07 |
| IUPAC Name | 2-[4-[(E)-2-(1,3-benzothiazol-2-yl)-2-cyanoethenyl]phenoxy]acetamide |
| SMILES | N#C/C(=C\c1ccc(OCC(N)=O)cc1)c1nc2ccccc2s1 |
| InChI | InChI=1S/C18H13N3O2S/c19-10-13(18-21-15-3-1-2-4-16(15)24-18)9-12-5-7-14(8-6-12)23-11-17(20)22/h1-9H,11H2,(H2,20,22)/b13-9+ |
| InChIKey | OERGTXFVKYWJKU-UKTHLTGXSA-N |
| XLogP | 3.22 |
| TPSA | 89.00 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 335.39 |
| LogP ≤ 5 | 3.22 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'conjugated_nitrile_group', 'substructure': 'N/A'} |
|---|