C27H16N2O2S — CID 3577359
[4-[2-(1,3-benzothiazol-2-yl)-2-cyanoethenyl]phenyl] naphthalene-1-carboxylate (PubChem CID 3577359) has the molecular formula C27H16N2O2S and a molecular weight of 432.50 g/mol. Its IUPAC name is [4-[2-(1,3-benzothiazol-2-yl)-2-cyanoethenyl]phenyl] naphthalene-1-carboxylate.
| Compound Name | [4-[2-(1,3-benzothiazol-2-yl)-2-cyanoethenyl]phenyl] naphthalene-1-carboxylate |
|---|---|
| PubChem CID | 3577359 |
| Molecular Formula | C27H16N2O2S |
| Molecular Weight | 432.50 g/mol |
| Exact Mass | 432.09 |
| IUPAC Name | [4-[2-(1,3-benzothiazol-2-yl)-2-cyanoethenyl]phenyl] naphthalene-1-carboxylate |
| SMILES | N#CC(=Cc1ccc(OC(=O)c2cccc3ccccc23)cc1)c1nc2ccccc2s1 |
| InChI | InChI=1S/C27H16N2O2S/c28-17-20(26-29-24-10-3-4-11-25(24)32-26)16-18-12-14-21(15-13-18)31-27(30)23-9-5-7-19-6-1-2-8-22(19)23/h1-16H |
| InChIKey | GNMKKDTYKYIZFI-UHFFFAOYSA-N |
| XLogP | 6.73 |
| TPSA | 62.98 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 432.50 |
| LogP ≤ 5 | 6.73 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'conjugated_nitrile_group', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|