C29H25N3O5S2 — CID 98141838
[4-[(E)-2-(1,3-benzothiazol-2-yl)-2-cyanoethenyl]phenyl] 4-[(2R,6R)-2,6-dimethylmorpholin-4-yl]sulfonylbenzoate (PubChem CID 98141838) has the molecular formula C29H25N3O5S2 and a molecular weight of 559.67 g/mol. Its IUPAC name is [4-[(E)-2-(1,3-benzothiazol-2-yl)-2-cyanoethenyl]phenyl] 4-[(2R,6R)-2,6-dimethylmorpholin-4-yl]sulfonylbenzoate.
| Compound Name | [4-[(E)-2-(1,3-benzothiazol-2-yl)-2-cyanoethenyl]phenyl] 4-[(2R,6R)-2,6-dimethylmorpholin-4-yl]sulfonylbenzoate |
|---|---|
| PubChem CID | 98141838 |
| Molecular Formula | C29H25N3O5S2 |
| Molecular Weight | 559.67 g/mol |
| Exact Mass | 559.12 |
| IUPAC Name | [4-[(E)-2-(1,3-benzothiazol-2-yl)-2-cyanoethenyl]phenyl] 4-[(2R,6R)-2,6-dimethylmorpholin-4-yl]sulfonylbenzoate |
| SMILES | C[C@@H]1CN(S(=O)(=O)c2ccc(C(=O)Oc3ccc(/C=C(\C#N)c4nc5ccccc5s4)cc3)cc2)C[C@@H](C)O1 |
| InChI | InChI=1S/C29H25N3O5S2/c1-19-17-32(18-20(2)36-19)39(34,35)25-13-9-22(10-14-25)29(33)37-24-11-7-21(8-12-24)15-23(16-30)28-31-26-5-3-4-6-27(26)38-28/h3-15,19-20H,17-18H2,1-2H3/b23-15+/t19-,20-/m1/s1 |
| InChIKey | UYHHGHATHSRWIJ-RHVVXLNXSA-N |
| XLogP | 5.38 |
| TPSA | 109.59 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 39 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 559.67 |
| LogP ≤ 5 | 5.38 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'conjugated_nitrile_group', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|