C20H19N3O2S — CID 40616231
(E)-2-(1,3-benzothiazol-2-yl)-3-[5-[(2S,6S)-2,6-dimethylmorpholin-4-yl]furan-2-yl]prop-2-enenitrile (PubChem CID 40616231) has the molecular formula C20H19N3O2S and a molecular weight of 365.46 g/mol. Its IUPAC name is (E)-2-(1,3-benzothiazol-2-yl)-3-[5-[(2S,6S)-2,6-dimethylmorpholin-4-yl]furan-2-yl]prop-2-enenitrile.
| Compound Name | (E)-2-(1,3-benzothiazol-2-yl)-3-[5-[(2S,6S)-2,6-dimethylmorpholin-4-yl]furan-2-yl]prop-2-enenitrile |
|---|---|
| PubChem CID | 40616231 |
| Molecular Formula | C20H19N3O2S |
| Molecular Weight | 365.46 g/mol |
| Exact Mass | 365.12 |
| IUPAC Name | (E)-2-(1,3-benzothiazol-2-yl)-3-[5-[(2S,6S)-2,6-dimethylmorpholin-4-yl]furan-2-yl]prop-2-enenitrile |
| SMILES | C[C@H]1CN(c2ccc(/C=C(\C#N)c3nc4ccccc4s3)o2)C[C@H](C)O1 |
| InChI | InChI=1S/C20H19N3O2S/c1-13-11-23(12-14(2)24-13)19-8-7-16(25-19)9-15(10-21)20-22-17-5-3-4-6-18(17)26-20/h3-9,13-14H,11-12H2,1-2H3/b15-9+/t13-,14-/m0/s1 |
| InChIKey | DESDMKXVWINOHT-CAMKDYJDSA-N |
| XLogP | 4.57 |
| TPSA | 62.29 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 365.46 |
| LogP ≤ 5 | 4.57 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'anil_di_alk_furan_B(2)', 'substructure': 'N/A'}, {'alert_name': 'conjugated_nitrile_group', 'substructure': 'N/A'} |
|---|