C18H14N2S — CID 6140962
(E)-2-(1,3-benzothiazol-2-yl)-3-(4-ethylphenyl)prop-2-enenitrile (PubChem CID 6140962) has the molecular formula C18H14N2S and a molecular weight of 290.39 g/mol. Its IUPAC name is (E)-2-(1,3-benzothiazol-2-yl)-3-(4-ethylphenyl)prop-2-enenitrile.
| Compound Name | (E)-2-(1,3-benzothiazol-2-yl)-3-(4-ethylphenyl)prop-2-enenitrile |
|---|---|
| PubChem CID | 6140962 |
| Molecular Formula | C18H14N2S |
| Molecular Weight | 290.39 g/mol |
| Exact Mass | 290.09 |
| IUPAC Name | (E)-2-(1,3-benzothiazol-2-yl)-3-(4-ethylphenyl)prop-2-enenitrile |
| SMILES | CCc1ccc(/C=C(\C#N)c2nc3ccccc3s2)cc1 |
| InChI | InChI=1S/C18H14N2S/c1-2-13-7-9-14(10-8-13)11-15(12-19)18-20-16-5-3-4-6-17(16)21-18/h3-11H,2H2,1H3/b15-11+ |
| InChIKey | AQWZNMVCYHIVIG-RVDMUPIBSA-N |
| XLogP | 4.92 |
| TPSA | 36.68 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 290.39 |
| LogP ≤ 5 | 4.92 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'conjugated_nitrile_group', 'substructure': 'N/A'} |
|---|