C23H16N2O3S — CID 3827630
ethyl 4-[5-[2-(1,3-benzothiazol-2-yl)-2-cyanoethenyl]furan-2-yl]benzoate (PubChem CID 3827630) has the molecular formula C23H16N2O3S and a molecular weight of 400.46 g/mol. Its IUPAC name is ethyl 4-[5-[2-(1,3-benzothiazol-2-yl)-2-cyanoethenyl]furan-2-yl]benzoate.
| Compound Name | ethyl 4-[5-[2-(1,3-benzothiazol-2-yl)-2-cyanoethenyl]furan-2-yl]benzoate |
|---|---|
| PubChem CID | 3827630 |
| Molecular Formula | C23H16N2O3S |
| Molecular Weight | 400.46 g/mol |
| Exact Mass | 400.09 |
| IUPAC Name | ethyl 4-[5-[2-(1,3-benzothiazol-2-yl)-2-cyanoethenyl]furan-2-yl]benzoate |
| SMILES | CCOC(=O)c1ccc(-c2ccc(C=C(C#N)c3nc4ccccc4s3)o2)cc1 |
| InChI | InChI=1S/C23H16N2O3S/c1-2-27-23(26)16-9-7-15(8-10-16)20-12-11-18(28-20)13-17(14-24)22-25-19-5-3-4-6-21(19)29-22/h3-13H,2H2,1H3 |
| InChIKey | WOPUEZXIRJJBHU-UHFFFAOYSA-N |
| XLogP | 5.80 |
| TPSA | 76.12 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 400.46 |
| LogP ≤ 5 | 5.80 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'conjugated_nitrile_group', 'substructure': 'N/A'} |
|---|