C33H25N3O4S — CID 4711105
ethyl 4-[5-[2-[5-benzamido-4-(4-methylphenyl)-1,3-thiazol-2-yl]-2-cyanoethenyl]furan-2-yl]benzoate (PubChem CID 4711105) has the molecular formula C33H25N3O4S and a molecular weight of 559.65 g/mol. Its IUPAC name is ethyl 4-[5-[2-[5-benzamido-4-(4-methylphenyl)-1,3-thiazol-2-yl]-2-cyanoethenyl]furan-2-yl]benzoate.
| Compound Name | ethyl 4-[5-[2-[5-benzamido-4-(4-methylphenyl)-1,3-thiazol-2-yl]-2-cyanoethenyl]furan-2-yl]benzoate |
|---|---|
| PubChem CID | 4711105 |
| Molecular Formula | C33H25N3O4S |
| Molecular Weight | 559.65 g/mol |
| Exact Mass | 559.16 |
| IUPAC Name | ethyl 4-[5-[2-[5-benzamido-4-(4-methylphenyl)-1,3-thiazol-2-yl]-2-cyanoethenyl]furan-2-yl]benzoate |
| SMILES | CCOC(=O)c1ccc(-c2ccc(C=C(C#N)c3nc(-c4ccc(C)cc4)c(NC(=O)c4ccccc4)s3)o2)cc1 |
| InChI | InChI=1S/C33H25N3O4S/c1-3-39-33(38)25-15-13-22(14-16-25)28-18-17-27(40-28)19-26(20-34)31-35-29(23-11-9-21(2)10-12-23)32(41-31)36-30(37)24-7-5-4-6-8-24/h4-19H,3H2,1-2H3,(H,36,37) |
| InChIKey | LSAYKHNQIXLSGH-UHFFFAOYSA-N |
| XLogP | 7.87 |
| TPSA | 105.22 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 41 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 559.65 |
| LogP ≤ 5 | 7.87 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'conjugated_nitrile_group', 'substructure': 'N/A'} |
|---|