C24H17N3OS2 — CID 92947302
N-[2-[(Z)-1-cyano-2-(4-methylphenyl)ethenyl]-4-phenyl-1,3-thiazol-5-yl]thiophene-2-carboxamide (PubChem CID 92947302) has the molecular formula C24H17N3OS2 and a molecular weight of 427.55 g/mol. Its IUPAC name is N-[2-[(Z)-1-cyano-2-(4-methylphenyl)ethenyl]-4-phenyl-1,3-thiazol-5-yl]thiophene-2-carboxamide.
| Compound Name | N-[2-[(Z)-1-cyano-2-(4-methylphenyl)ethenyl]-4-phenyl-1,3-thiazol-5-yl]thiophene-2-carboxamide |
|---|---|
| PubChem CID | 92947302 |
| Molecular Formula | C24H17N3OS2 |
| Molecular Weight | 427.55 g/mol |
| Exact Mass | 427.08 |
| IUPAC Name | N-[2-[(Z)-1-cyano-2-(4-methylphenyl)ethenyl]-4-phenyl-1,3-thiazol-5-yl]thiophene-2-carboxamide |
| SMILES | Cc1ccc(/C=C(/C#N)c2nc(-c3ccccc3)c(NC(=O)c3cccs3)s2)cc1 |
| InChI | InChI=1S/C24H17N3OS2/c1-16-9-11-17(12-10-16)14-19(15-25)23-26-21(18-6-3-2-4-7-18)24(30-23)27-22(28)20-8-5-13-29-20/h2-14H,1H3,(H,27,28)/b19-14- |
| InChIKey | XTOCKMNSVSDEGV-RGEXLXHISA-N |
| XLogP | 6.50 |
| TPSA | 65.78 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 427.55 |
| LogP ≤ 5 | 6.50 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'conjugated_nitrile_group', 'substructure': 'N/A'} |
|---|