C27H23ClN4OS2 — CID 34314198
4-chloro-N-[2-[(Z)-1-cyano-2-[4-(diethylamino)phenyl]ethenyl]-4-thiophen-2-yl-1,3-thiazol-5-yl]benzamide (PubChem CID 34314198) has the molecular formula C27H23ClN4OS2 and a molecular weight of 519.10 g/mol. Its IUPAC name is 4-chloro-N-[2-[(Z)-1-cyano-2-[4-(diethylamino)phenyl]ethenyl]-4-thiophen-2-yl-1,3-thiazol-5-yl]benzamide.
| Compound Name | 4-chloro-N-[2-[(Z)-1-cyano-2-[4-(diethylamino)phenyl]ethenyl]-4-thiophen-2-yl-1,3-thiazol-5-yl]benzamide |
|---|---|
| PubChem CID | 34314198 |
| Molecular Formula | C27H23ClN4OS2 |
| Molecular Weight | 519.10 g/mol |
| Exact Mass | 518.10 |
| IUPAC Name | 4-chloro-N-[2-[(Z)-1-cyano-2-[4-(diethylamino)phenyl]ethenyl]-4-thiophen-2-yl-1,3-thiazol-5-yl]benzamide |
| SMILES | CCN(CC)c1ccc(/C=C(/C#N)c2nc(-c3cccs3)c(NC(=O)c3ccc(Cl)cc3)s2)cc1 |
| InChI | InChI=1S/C27H23ClN4OS2/c1-3-32(4-2)22-13-7-18(8-14-22)16-20(17-29)26-30-24(23-6-5-15-34-23)27(35-26)31-25(33)19-9-11-21(28)12-10-19/h5-16H,3-4H2,1-2H3,(H,31,33)/b20-16- |
| InChIKey | JVYMWEMOWIATHM-SILNSSARSA-N |
| XLogP | 7.69 |
| TPSA | 69.02 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 35 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 519.10 |
| LogP ≤ 5 | 7.69 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'anil_di_alk_B(251)', 'substructure': 'N/A'}, {'alert_name': 'conjugated_nitrile_group', 'substructure': 'N/A'} |
|---|