C18H12ClN3OS — CID 15497678
4-chloro-N-[2-(cyanomethyl)-4-phenyl-1,3-thiazol-5-yl]benzamide (PubChem CID 15497678) has the molecular formula C18H12ClN3OS and a molecular weight of 353.83 g/mol. Its IUPAC name is 4-chloro-N-[2-(cyanomethyl)-4-phenyl-1,3-thiazol-5-yl]benzamide.
| Compound Name | 4-chloro-N-[2-(cyanomethyl)-4-phenyl-1,3-thiazol-5-yl]benzamide |
|---|---|
| PubChem CID | 15497678 |
| Molecular Formula | C18H12ClN3OS |
| Molecular Weight | 353.83 g/mol |
| Exact Mass | 353.04 |
| IUPAC Name | 4-chloro-N-[2-(cyanomethyl)-4-phenyl-1,3-thiazol-5-yl]benzamide |
| SMILES | N#CCc1nc(-c2ccccc2)c(NC(=O)c2ccc(Cl)cc2)s1 |
| InChI | InChI=1S/C18H12ClN3OS/c19-14-8-6-13(7-9-14)17(23)22-18-16(12-4-2-1-3-5-12)21-15(24-18)10-11-20/h1-9H,10H2,(H,22,23) |
| InChIKey | RQMNMQRUNDGHBK-UHFFFAOYSA-N |
| XLogP | 4.78 |
| TPSA | 65.78 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 353.83 |
| LogP ≤ 5 | 4.78 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'thiazole_amine_E(2)', 'substructure': 'N/A'} |
|---|