C24H17Cl2N3O3S — CID 46300079
N-[2-[[2-(2,4-dichlorophenoxy)acetyl]amino]-4-phenyl-1,3-thiazol-5-yl]benzamide (PubChem CID 46300079) has the molecular formula C24H17Cl2N3O3S and a molecular weight of 498.39 g/mol. Its IUPAC name is N-[2-[[2-(2,4-dichlorophenoxy)acetyl]amino]-4-phenyl-1,3-thiazol-5-yl]benzamide.
| Compound Name | N-[2-[[2-(2,4-dichlorophenoxy)acetyl]amino]-4-phenyl-1,3-thiazol-5-yl]benzamide |
|---|---|
| PubChem CID | 46300079 |
| Molecular Formula | C24H17Cl2N3O3S |
| Molecular Weight | 498.39 g/mol |
| Exact Mass | 497.04 |
| IUPAC Name | N-[2-[[2-(2,4-dichlorophenoxy)acetyl]amino]-4-phenyl-1,3-thiazol-5-yl]benzamide |
| SMILES | O=C(COc1ccc(Cl)cc1Cl)Nc1nc(-c2ccccc2)c(NC(=O)c2ccccc2)s1 |
| InChI | InChI=1S/C24H17Cl2N3O3S/c25-17-11-12-19(18(26)13-17)32-14-20(30)27-24-28-21(15-7-3-1-4-8-15)23(33-24)29-22(31)16-9-5-2-6-10-16/h1-13H,14H2,(H,29,31)(H,27,28,30) |
| InChIKey | TYBJQDVTEZNDOT-UHFFFAOYSA-N |
| XLogP | 6.39 |
| TPSA | 80.32 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 498.39 |
| LogP ≤ 5 | 6.39 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |