C23H15ClN4O4S — CID 34306834
N-[5-[(4-chlorobenzoyl)amino]-4-phenyl-1,3-thiazol-2-yl]-4-nitrobenzamide (PubChem CID 34306834) has the molecular formula C23H15ClN4O4S and a molecular weight of 478.92 g/mol. Its IUPAC name is N-[5-[(4-chlorobenzoyl)amino]-4-phenyl-1,3-thiazol-2-yl]-4-nitrobenzamide.
| Compound Name | N-[5-[(4-chlorobenzoyl)amino]-4-phenyl-1,3-thiazol-2-yl]-4-nitrobenzamide |
|---|---|
| PubChem CID | 34306834 |
| Molecular Formula | C23H15ClN4O4S |
| Molecular Weight | 478.92 g/mol |
| Exact Mass | 478.05 |
| IUPAC Name | N-[5-[(4-chlorobenzoyl)amino]-4-phenyl-1,3-thiazol-2-yl]-4-nitrobenzamide |
| SMILES | O=C(Nc1nc(-c2ccccc2)c(NC(=O)c2ccc(Cl)cc2)s1)c1ccc([N+](=O)[O-])cc1 |
| InChI | InChI=1S/C23H15ClN4O4S/c24-17-10-6-15(7-11-17)20(29)26-22-19(14-4-2-1-3-5-14)25-23(33-22)27-21(30)16-8-12-18(13-9-16)28(31)32/h1-13H,(H,26,29)(H,25,27,30) |
| InChIKey | JQHYVJYPMPWWLJ-UHFFFAOYSA-N |
| XLogP | 5.88 |
| TPSA | 114.23 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 478.92 |
| LogP ≤ 5 | 5.88 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|