C20H16N4O5S — CID 121065466
methyl N-[5-[[(Z)-3-(4-nitrophenyl)prop-2-enoyl]amino]-4-phenyl-1,3-thiazol-2-yl]carbamate (PubChem CID 121065466) has the molecular formula C20H16N4O5S and a molecular weight of 424.44 g/mol. Its IUPAC name is methyl N-[5-[[(Z)-3-(4-nitrophenyl)prop-2-enoyl]amino]-4-phenyl-1,3-thiazol-2-yl]carbamate.
| Compound Name | methyl N-[5-[[(Z)-3-(4-nitrophenyl)prop-2-enoyl]amino]-4-phenyl-1,3-thiazol-2-yl]carbamate |
|---|---|
| PubChem CID | 121065466 |
| Molecular Formula | C20H16N4O5S |
| Molecular Weight | 424.44 g/mol |
| Exact Mass | 424.08 |
| IUPAC Name | methyl N-[5-[[(Z)-3-(4-nitrophenyl)prop-2-enoyl]amino]-4-phenyl-1,3-thiazol-2-yl]carbamate |
| SMILES | COC(=O)Nc1nc(-c2ccccc2)c(NC(=O)/C=C\c2ccc([N+](=O)[O-])cc2)s1 |
| InChI | InChI=1S/C20H16N4O5S/c1-29-20(26)23-19-22-17(14-5-3-2-4-6-14)18(30-19)21-16(25)12-9-13-7-10-15(11-8-13)24(27)28/h2-12H,1H3,(H,21,25)(H,22,23,26)/b12-9- |
| InChIKey | JIIKVXVDNNVCHW-XFXZXTDPSA-N |
| XLogP | 4.55 |
| TPSA | 123.46 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 424.44 |
| LogP ≤ 5 | 4.55 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|