C18H11ClN2OS3 — CID 171703835
4-chloro-N-(2,4-dithiophen-2-yl-1,3-thiazol-5-yl)benzamide (PubChem CID 171703835) has the molecular formula C18H11ClN2OS3 and a molecular weight of 402.95 g/mol. Its IUPAC name is 4-chloro-N-(2,4-dithiophen-2-yl-1,3-thiazol-5-yl)benzamide.
| Compound Name | 4-chloro-N-(2,4-dithiophen-2-yl-1,3-thiazol-5-yl)benzamide |
|---|---|
| PubChem CID | 171703835 |
| Molecular Formula | C18H11ClN2OS3 |
| Molecular Weight | 402.95 g/mol |
| Exact Mass | 401.97 |
| IUPAC Name | 4-chloro-N-(2,4-dithiophen-2-yl-1,3-thiazol-5-yl)benzamide |
| SMILES | O=C(Nc1sc(-c2cccs2)nc1-c1cccs1)c1ccc(Cl)cc1 |
| InChI | InChI=1S/C18H11ClN2OS3/c19-12-7-5-11(6-8-12)16(22)21-18-15(13-3-1-9-23-13)20-17(25-18)14-4-2-10-24-14/h1-10H,(H,21,22) |
| InChIKey | AERVALPGKKTZPU-UHFFFAOYSA-N |
| XLogP | 6.51 |
| TPSA | 41.99 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 25 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 402.95 |
| LogP ≤ 5 | 6.51 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |