C18H11ClIN3OS — CID 166636339
4-chloro-N-(6-iodo-2-thiophen-2-ylimidazo[1,2-a]pyridin-3-yl)benzamide (PubChem CID 166636339) has the molecular formula C18H11ClIN3OS and a molecular weight of 479.73 g/mol. Its IUPAC name is 4-chloro-N-(6-iodo-2-thiophen-2-ylimidazo[1,2-a]pyridin-3-yl)benzamide.
| Compound Name | 4-chloro-N-(6-iodo-2-thiophen-2-ylimidazo[1,2-a]pyridin-3-yl)benzamide |
|---|---|
| PubChem CID | 166636339 |
| Molecular Formula | C18H11ClIN3OS |
| Molecular Weight | 479.73 g/mol |
| Exact Mass | 478.94 |
| IUPAC Name | 4-chloro-N-(6-iodo-2-thiophen-2-ylimidazo[1,2-a]pyridin-3-yl)benzamide |
| SMILES | O=C(Nc1c(-c2cccs2)nc2ccc(I)cn12)c1ccc(Cl)cc1 |
| InChI | InChI=1S/C18H11ClIN3OS/c19-12-5-3-11(4-6-12)18(24)22-17-16(14-2-1-9-25-14)21-15-8-7-13(20)10-23(15)17/h1-10H,(H,22,24) |
| InChIKey | ANNOEIZZDONHQD-UHFFFAOYSA-N |
| XLogP | 5.57 |
| TPSA | 46.40 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 25 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 479.73 |
| LogP ≤ 5 | 5.57 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|