C16H11ClFN3OS — CID 51065363
N-[2-amino-4-(4-fluorophenyl)-1,3-thiazol-5-yl]-4-chlorobenzamide (PubChem CID 51065363) has the molecular formula C16H11ClFN3OS and a molecular weight of 347.80 g/mol. Its IUPAC name is N-[2-amino-4-(4-fluorophenyl)-1,3-thiazol-5-yl]-4-chlorobenzamide.
| Compound Name | N-[2-amino-4-(4-fluorophenyl)-1,3-thiazol-5-yl]-4-chlorobenzamide |
|---|---|
| PubChem CID | 51065363 |
| Molecular Formula | C16H11ClFN3OS |
| Molecular Weight | 347.80 g/mol |
| Exact Mass | 347.03 |
| IUPAC Name | N-[2-amino-4-(4-fluorophenyl)-1,3-thiazol-5-yl]-4-chlorobenzamide |
| SMILES | Nc1nc(-c2ccc(F)cc2)c(NC(=O)c2ccc(Cl)cc2)s1 |
| InChI | InChI=1S/C16H11ClFN3OS/c17-11-5-1-10(2-6-11)14(22)21-15-13(20-16(19)23-15)9-3-7-12(18)8-4-9/h1-8H,(H2,19,20)(H,21,22) |
| InChIKey | GWWDZCRHKZNJJV-UHFFFAOYSA-N |
| XLogP | 4.44 |
| TPSA | 68.01 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 347.80 |
| LogP ≤ 5 | 4.44 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |