C17H14ClN3OS — CID 35673976
N-[2-amino-4-(4-methylphenyl)-1,3-thiazol-5-yl]-4-chlorobenzamide (PubChem CID 35673976) has the molecular formula C17H14ClN3OS and a molecular weight of 343.84 g/mol. Its IUPAC name is N-[2-amino-4-(4-methylphenyl)-1,3-thiazol-5-yl]-4-chlorobenzamide.
| Compound Name | N-[2-amino-4-(4-methylphenyl)-1,3-thiazol-5-yl]-4-chlorobenzamide |
|---|---|
| PubChem CID | 35673976 |
| Molecular Formula | C17H14ClN3OS |
| Molecular Weight | 343.84 g/mol |
| Exact Mass | 343.05 |
| IUPAC Name | N-[2-amino-4-(4-methylphenyl)-1,3-thiazol-5-yl]-4-chlorobenzamide |
| SMILES | Cc1ccc(-c2nc(N)sc2NC(=O)c2ccc(Cl)cc2)cc1 |
| InChI | InChI=1S/C17H14ClN3OS/c1-10-2-4-11(5-3-10)14-16(23-17(19)20-14)21-15(22)12-6-8-13(18)9-7-12/h2-9H,1H3,(H2,19,20)(H,21,22) |
| InChIKey | PFSVESGUJILFFZ-UHFFFAOYSA-N |
| XLogP | 4.61 |
| TPSA | 68.01 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 343.84 |
| LogP ≤ 5 | 4.61 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |