C19H12Br2N2S — CID 3139736
3-(4-bromophenyl)-2-[4-(4-bromophenyl)-5-methyl-1,3-thiazol-2-yl]prop-2-enenitrile (PubChem CID 3139736) has the molecular formula C19H12Br2N2S and a molecular weight of 460.19 g/mol. Its IUPAC name is 3-(4-bromophenyl)-2-[4-(4-bromophenyl)-5-methyl-1,3-thiazol-2-yl]prop-2-enenitrile.
| Compound Name | 3-(4-bromophenyl)-2-[4-(4-bromophenyl)-5-methyl-1,3-thiazol-2-yl]prop-2-enenitrile |
|---|---|
| PubChem CID | 3139736 |
| Molecular Formula | C19H12Br2N2S |
| Molecular Weight | 460.19 g/mol |
| Exact Mass | 457.91 |
| IUPAC Name | 3-(4-bromophenyl)-2-[4-(4-bromophenyl)-5-methyl-1,3-thiazol-2-yl]prop-2-enenitrile |
| SMILES | Cc1sc(C(C#N)=Cc2ccc(Br)cc2)nc1-c1ccc(Br)cc1 |
| InChI | InChI=1S/C19H12Br2N2S/c1-12-18(14-4-8-17(21)9-5-14)23-19(24-12)15(11-22)10-13-2-6-16(20)7-3-13/h2-10H,1H3 |
| InChIKey | YPFHXVWOOQCLEP-UHFFFAOYSA-N |
| XLogP | 6.71 |
| TPSA | 36.68 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 24 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 460.19 |
| LogP ≤ 5 | 6.71 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'conjugated_nitrile_group', 'substructure': 'N/A'} |
|---|