C21H16N4O2S2 — CID 135555294
N-[2-[(2E)-2-[(4-hydroxyphenyl)methylidene]hydrazinyl]-4-phenyl-1,3-thiazol-5-yl]thiophene-2-carboxamide (PubChem CID 135555294) has the molecular formula C21H16N4O2S2 and a molecular weight of 420.52 g/mol. Its IUPAC name is N-[2-[(2E)-2-[(4-hydroxyphenyl)methylidene]hydrazinyl]-4-phenyl-1,3-thiazol-5-yl]thiophene-2-carboxamide.
| Compound Name | N-[2-[(2E)-2-[(4-hydroxyphenyl)methylidene]hydrazinyl]-4-phenyl-1,3-thiazol-5-yl]thiophene-2-carboxamide |
|---|---|
| PubChem CID | 135555294 |
| Molecular Formula | C21H16N4O2S2 |
| Molecular Weight | 420.52 g/mol |
| Exact Mass | 420.07 |
| IUPAC Name | N-[2-[(2E)-2-[(4-hydroxyphenyl)methylidene]hydrazinyl]-4-phenyl-1,3-thiazol-5-yl]thiophene-2-carboxamide |
| SMILES | O=C(Nc1sc(N/N=C/c2ccc(O)cc2)nc1-c1ccccc1)c1cccs1 |
| InChI | InChI=1S/C21H16N4O2S2/c26-16-10-8-14(9-11-16)13-22-25-21-23-18(15-5-2-1-3-6-15)20(29-21)24-19(27)17-7-4-12-28-17/h1-13,26H,(H,23,25)(H,24,27)/b22-13+ |
| InChIKey | GQIPCUUNRASBJJ-LPYMAVHISA-N |
| XLogP | 5.28 |
| TPSA | 86.61 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 420.52 |
| LogP ≤ 5 | 5.28 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'hzone_phenol_B(215)', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|