C29H30N4OS — CID 27350378
N-[2-[(2Z)-2-[(4-tert-butylphenyl)methylidene]hydrazinyl]-4-(4-methylphenyl)-1,3-thiazol-5-yl]-2-phenylacetamide (PubChem CID 27350378) has the molecular formula C29H30N4OS and a molecular weight of 482.65 g/mol. Its IUPAC name is N-[2-[(2Z)-2-[(4-tert-butylphenyl)methylidene]hydrazinyl]-4-(4-methylphenyl)-1,3-thiazol-5-yl]-2-phenylacetamide.
| Compound Name | N-[2-[(2Z)-2-[(4-tert-butylphenyl)methylidene]hydrazinyl]-4-(4-methylphenyl)-1,3-thiazol-5-yl]-2-phenylacetamide |
|---|---|
| PubChem CID | 27350378 |
| Molecular Formula | C29H30N4OS |
| Molecular Weight | 482.65 g/mol |
| Exact Mass | 482.21 |
| IUPAC Name | N-[2-[(2Z)-2-[(4-tert-butylphenyl)methylidene]hydrazinyl]-4-(4-methylphenyl)-1,3-thiazol-5-yl]-2-phenylacetamide |
| SMILES | Cc1ccc(-c2nc(N/N=C\c3ccc(C(C)(C)C)cc3)sc2NC(=O)Cc2ccccc2)cc1 |
| InChI | InChI=1S/C29H30N4OS/c1-20-10-14-23(15-11-20)26-27(31-25(34)18-21-8-6-5-7-9-21)35-28(32-26)33-30-19-22-12-16-24(17-13-22)29(2,3)4/h5-17,19H,18H2,1-4H3,(H,31,34)(H,32,33)/b30-19- |
| InChIKey | JMEDJYVGFWAHSW-FSGOGVSDSA-N |
| XLogP | 7.04 |
| TPSA | 66.38 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 482.65 |
| LogP ≤ 5 | 7.04 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|