C23H22BrN3O3S — CID 169409654
ethyl 2-[4-(4-bromophenyl)-2-[2-[(4-methylphenyl)methylidene]hydrazinyl]-1,3-thiazol-5-yl]-3-hydroxybut-2-enoate (PubChem CID 169409654) has the molecular formula C23H22BrN3O3S and a molecular weight of 500.42 g/mol. Its IUPAC name is ethyl 2-[4-(4-bromophenyl)-2-[2-[(4-methylphenyl)methylidene]hydrazinyl]-1,3-thiazol-5-yl]-3-hydroxybut-2-enoate.
| Compound Name | ethyl 2-[4-(4-bromophenyl)-2-[2-[(4-methylphenyl)methylidene]hydrazinyl]-1,3-thiazol-5-yl]-3-hydroxybut-2-enoate |
|---|---|
| PubChem CID | 169409654 |
| Molecular Formula | C23H22BrN3O3S |
| Molecular Weight | 500.42 g/mol |
| Exact Mass | 499.06 |
| IUPAC Name | ethyl 2-[4-(4-bromophenyl)-2-[2-[(4-methylphenyl)methylidene]hydrazinyl]-1,3-thiazol-5-yl]-3-hydroxybut-2-enoate |
| SMILES | CCOC(=O)C(=C(C)O)c1sc(NN=Cc2ccc(C)cc2)nc1-c1ccc(Br)cc1 |
| InChI | InChI=1S/C23H22BrN3O3S/c1-4-30-22(29)19(15(3)28)21-20(17-9-11-18(24)12-10-17)26-23(31-21)27-25-13-16-7-5-14(2)6-8-16/h5-13,28H,4H2,1-3H3,(H,26,27) |
| InChIKey | XXWIVNSBSBBJOM-UHFFFAOYSA-N |
| XLogP | 6.18 |
| TPSA | 83.81 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 31 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 500.42 |
| LogP ≤ 5 | 6.18 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|